Products 1350539-93-3
CAS 1350539-93-3 is the registry number for 3-(Dimethylamino)-5-fluorobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
3-(dimethylamino)-5-fluorobenzoic acid (CAS 1350539-93-3) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: 3-(dimethylamino)-5-fluorobenzoic acid. InChIKey: BDHPSWFBNFLKBM-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | 3-(dimethylamino)-5-fluorobenzoic acid |
| InChIKey | BDHPSWFBNFLKBM-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)