CAS 1350614-84-4 is the registry number for Perfluorooctanoic acid 13C8 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2,3,4,5,6,7,8-13C8)octanoic acid (CAS 1350614-84-4) is a chemical compound with the molecular formula C8HF15O2 and a molecular weight of 422.010 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2,3,4,5,6,7,8-13C8)octanoic acid. InChIKey: SNGREZUHAYWORS-LLXNCONNSA-N.
| Molecular formula | C8HF15O2 |
|---|---|
| Molecular weight | 422.010 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2,3,4,5,6,7,8-13C8)octanoic acid |
| InChIKey | SNGREZUHAYWORS-LLXNCONNSA-N |
| SMILES | [13C](=O)([13C]([13C]([13C]([13C]([13C]([13C]([13C](F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)