CAS 960315-48-4 is the registry number for Perfluorooctanoic acid 13C4 (1,2,3,4-13C4) 50 µg/mL in Methanol:Water. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2,3,4-13C4)octanoic acid (CAS 960315-48-4) is a chemical compound with the molecular formula C8HF15O2 and a molecular weight of 418.04 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2,3,4-13C4)octanoic acid. InChIKey: SNGREZUHAYWORS-JCDJMFQYSA-N.
| Molecular formula | C8HF15O2 |
|---|---|
| Molecular weight | 418.04 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro(1,2,3,4-13C4)octanoic acid |
| InChIKey | SNGREZUHAYWORS-JCDJMFQYSA-N |
| SMILES | [13C](=O)([13C]([13C]([13C](C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)