CAS 1350637-18-1 is the registry number for (4-Bromophenyl)-(2,2-difluorocyclopropyl)methanone, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-bromophenyl)-(2,2-difluorocyclopropyl)methanone (CAS 1350637-18-1) is a chemical compound with the molecular formula C10H7BrF2O and a molecular weight of 261.06 g/mol. IUPAC name: (4-bromophenyl)-(2,2-difluorocyclopropyl)methanone. InChIKey: TTWFANBUTKLYHW-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF2O |
|---|---|
| Molecular weight | 261.06 g/mol |
| IUPAC name | (4-bromophenyl)-(2,2-difluorocyclopropyl)methanone |
| InChIKey | TTWFANBUTKLYHW-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)