CAS 2772614-29-4 is the registry number for 5-Bromo-4,4-difluoro-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-one (CAS 2772614-29-4) is a chemical compound with the molecular formula C10H7BrF2O and a molecular weight of 261.06 g/mol. IUPAC name: 5-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-one. InChIKey: AKXFILHAIGGMEE-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF2O |
|---|---|
| Molecular weight | 261.06 g/mol |
| IUPAC name | 5-bromo-4,4-difluoro-2,3-dihydronaphthalen-1-one |
| InChIKey | AKXFILHAIGGMEE-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1=O)C=CC=C2Br)(F)F |
Computed by PubChem (NCBI)