CAS 2623195-89-9 is the registry number for 7-Bromo-2,2-difluoro-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-2,2-difluoro-3,4-dihydronaphthalen-1-one (CAS 2623195-89-9) is a chemical compound with the molecular formula C10H7BrF2O and a molecular weight of 261.06 g/mol. IUPAC name: 7-bromo-2,2-difluoro-3,4-dihydronaphthalen-1-one. InChIKey: VVROLPYGCCHOMW-UHFFFAOYSA-N.
| Molecular formula | C10H7BrF2O |
|---|---|
| Molecular weight | 261.06 g/mol |
| IUPAC name | 7-bromo-2,2-difluoro-3,4-dihydronaphthalen-1-one |
| InChIKey | VVROLPYGCCHOMW-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C2=C1C=CC(=C2)Br)(F)F |
Computed by PubChem (NCBI)