Products 135066-21-6
CAS 135066-21-6 appears in our catalog under these names: 4-tert-Butoxyphenylacetic acid, 95%, 4-tert-Butoxyphenylacetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 500mg, 1000mg, 5000mg, 10000mg.
2-[4-[(2-methylpropan-2-yl)oxy]phenyl]acetic acid (CAS 135066-21-6) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-[4-[(2-methylpropan-2-yl)oxy]phenyl]acetic acid. InChIKey: XKDCCGWJZGTHPO-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2-[4-[(2-methylpropan-2-yl)oxy]phenyl]acetic acid |
| InChIKey | XKDCCGWJZGTHPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-tert-BUTOXYPHENYLACETIC ACID, 2-(4-(tert-Butoxy)phenyl)acetic acid, (4-tert-butoxyphenyl)acetic acid, 2-[4-(tert-butoxy)phenyl]acetic acid, 2-[4-[(2-methylpropan-2-yl)oxy]phenyl]acetic acid, Benzeneacetic acid,4-(1,1-dimethylethoxy)-, 4-(tert-Butoxy)benzeneacetic Acid, 2-(4-tert-butoxyphenyl)acetic acid, 2-[4-(t-Butoxy)phenyl]acetic acid, 2-(4-(tert-Butoxy)phenyl)aceticacid