CAS 1350768-53-4 is the registry number for (2S,5R)-5-Methyl-2-phenylmorpholine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,5R)-5-methyl-2-phenylmorpholine;hydrochloride (CAS 1350768-53-4) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (2S,5R)-5-methyl-2-phenylmorpholine;hydrochloride. InChIKey: JWPCTGQKTDWSIB-FOKYBFFNSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (2S,5R)-5-methyl-2-phenylmorpholine;hydrochloride |
| InChIKey | JWPCTGQKTDWSIB-FOKYBFFNSA-N |
| SMILES | C[C@@H]1CO[C@H](CN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)