CAS 954133-77-8 is the registry number for Isophenmetrazine Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
(2R,5R)-5-methyl-2-phenylmorpholine;hydrochloride (CAS 954133-77-8) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: (2R,5R)-5-methyl-2-phenylmorpholine;hydrochloride. InChIKey: JWPCTGQKTDWSIB-XQKZEKTMSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | (2R,5R)-5-methyl-2-phenylmorpholine;hydrochloride |
| InChIKey | JWPCTGQKTDWSIB-XQKZEKTMSA-N |
| SMILES | C[C@@H]1CO[C@@H](CN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)