Products 1350769-60-6
CAS 1350769-60-6 is the registry number for (2R,6S)-2-methyl-6-phenylmorpholine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2R,6S)-2-methyl-6-phenylmorpholine (CAS 1350769-60-6) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: (2R,6S)-2-methyl-6-phenylmorpholine. InChIKey: OEIVXYYFUJADLC-MWLCHTKSSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | (2R,6S)-2-methyl-6-phenylmorpholine |
| InChIKey | OEIVXYYFUJADLC-MWLCHTKSSA-N |
| SMILES | C[C@@H]1CNC[C@@H](O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)