Products 1350925-21-1
CAS 1350925-21-1 appears in our catalog under these names: 6–Chloropyrido(2，3–b)pyrazin–3(4H)–one, 6-Chloropyrido[2,3-b]pyrazin-3(4H)-one, 96%, 96%, 6-Chloropyrido[2,3-b]pyrazin-3(4H)-one, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 50mg, 1g.
6-chloro-4H-pyrido[2,3-b]pyrazin-3-one (CAS 1350925-21-1) is a chemical compound with the molecular formula C7H4ClN3O and a molecular weight of 181.58 g/mol. IUPAC name: 6-chloro-4H-pyrido[2,3-b]pyrazin-3-one. InChIKey: BKROTOZNASSZKV-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O |
|---|---|
| Molecular weight | 181.58 g/mol |
| IUPAC name | 6-chloro-4H-pyrido[2,3-b]pyrazin-3-one |
| InChIKey | BKROTOZNASSZKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=CC(=O)N2)Cl |
Computed by PubChem (NCBI)