CAS 135104-20-0 is the registry number for 2-Phenylpyrazolo[1,5-d][1,2,4]triazin-4(5H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-phenyl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one (CAS 135104-20-0) is a chemical compound with the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. IUPAC name: 2-phenyl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one. InChIKey: BLJSLKIFQXRXSE-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 2-phenyl-5H-pyrazolo[1,5-d][1,2,4]triazin-4-one |
| InChIKey | BLJSLKIFQXRXSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN3C=NNC(=O)C3=C2 |
Computed by PubChem (NCBI)