CAS 70015-80-4 appears in our catalog under these names: 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 1,6-dihydro-3-phenyl-, 95%, 3-Phenyl-1H-pyrazolo(4,3-d)pyrimidin-7(6H)-one, 95+%, 1,6-Dihydro-3-phenyl-7H-pyrazolo(4,3-d)pyrimidin-7-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3-phenyl-1,6-dihydropyrazolo[4,3-d]pyrimidin-7-one (CAS 70015-80-4) is a chemical compound with the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. IUPAC name: 3-phenyl-1,6-dihydropyrazolo[4,3-d]pyrimidin-7-one. InChIKey: GLLZFADCRQQBOU-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | 3-phenyl-1,6-dihydropyrazolo[4,3-d]pyrimidin-7-one |
| InChIKey | GLLZFADCRQQBOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC3=C2N=CNC3=O |
Computed by PubChem (NCBI)