CAS 1428084-43-8 is the registry number for N-(3-Ethynylphenyl)-1H-1,2,3-triazole-4-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-ethynylphenyl)-2H-triazole-4-carboxamide (CAS 1428084-43-8) is a chemical compound with the molecular formula C11H8N4O and a molecular weight of 212.21 g/mol. IUPAC name: N-(3-ethynylphenyl)-2H-triazole-4-carboxamide. InChIKey: ZYPAYSHFIPDFCE-UHFFFAOYSA-N.
| Molecular formula | C11H8N4O |
|---|---|
| Molecular weight | 212.21 g/mol |
| IUPAC name | N-(3-ethynylphenyl)-2H-triazole-4-carboxamide |
| InChIKey | ZYPAYSHFIPDFCE-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)NC(=O)C2=NNN=C2 |
Computed by PubChem (NCBI)