CAS 1351385-49-3 is the registry number for 4-(4-Bromophenyl)-1-ethylpyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(4-bromophenyl)-1-ethylpyrazole (CAS 1351385-49-3) is a chemical compound with the molecular formula C11H11BrN2 and a molecular weight of 251.12 g/mol. IUPAC name: 4-(4-bromophenyl)-1-ethylpyrazole. InChIKey: OYVXRZFNWKKKRQ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2 |
|---|---|
| Molecular weight | 251.12 g/mol |
| IUPAC name | 4-(4-bromophenyl)-1-ethylpyrazole |
| InChIKey | OYVXRZFNWKKKRQ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C=N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)