Products 1351843-58-7
CAS 1351843-58-7 is the registry number for 1-(4-Aminobenzyl)-n-phenyl-1h-imidazole-4-carboxamide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(4-aminophenyl)methyl]-N-phenylimidazole-4-carboxamide (CAS 1351843-58-7) is a chemical compound with the molecular formula C17H16N4O and a molecular weight of 292.33 g/mol. IUPAC name: 1-[(4-aminophenyl)methyl]-N-phenylimidazole-4-carboxamide. InChIKey: RCLJWEDRVBMVID-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 1-[(4-aminophenyl)methyl]-N-phenylimidazole-4-carboxamide |
| InChIKey | RCLJWEDRVBMVID-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CN(C=N2)CC3=CC=C(C=C3)N |
Computed by PubChem (NCBI)