CAS 337975-77-6 is the registry number for 3-(3-Methyl-1-phenyl-1H-pyrazol-5-yl)-1-phenylurea. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(5-methyl-2-phenylpyrazol-3-yl)-3-phenylurea (CAS 337975-77-6) is a chemical compound with the molecular formula C17H16N4O and a molecular weight of 292.33 g/mol. IUPAC name: 1-(5-methyl-2-phenylpyrazol-3-yl)-3-phenylurea. InChIKey: KJTYQAYFNWYLFE-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 1-(5-methyl-2-phenylpyrazol-3-yl)-3-phenylurea |
| InChIKey | KJTYQAYFNWYLFE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)NC(=O)NC2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)