Products 2342571-09-7
CAS 2342571-09-7 is the registry number for TTBK1/2-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[3-(2-aminopyrimidin-4-yl)-1H-indol-5-yl]-2-methylbut-3-yn-2-ol (CAS 2342571-09-7) is a chemical compound with the molecular formula C17H16N4O and a molecular weight of 292.33 g/mol. IUPAC name: 4-[3-(2-aminopyrimidin-4-yl)-1H-indol-5-yl]-2-methylbut-3-yn-2-ol. InChIKey: YYAZUVAPGBAUDQ-UHFFFAOYSA-N.
| Molecular formula | C17H16N4O |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | 4-[3-(2-aminopyrimidin-4-yl)-1H-indol-5-yl]-2-methylbut-3-yn-2-ol |
| InChIKey | YYAZUVAPGBAUDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C#CC1=CC2=C(C=C1)NC=C2C3=NC(=NC=C3)N)O |
Computed by PubChem (NCBI)