CAS 135206-97-2 appears in our catalog under these names: 2-(Chloromethyl)-1-(2,2-difluoroethyl)-1H-imidazole hydrochloride, 2-(Chloromethyl)-1-(2,2-difluoroethyl)-1H-imidazole hydrochloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(chloromethyl)-1-(2,2-difluoroethyl)imidazole;hydrochloride (CAS 135206-97-2) is a chemical compound with the molecular formula C6H8Cl2F2N2 and a molecular weight of 217.04 g/mol. IUPAC name: 2-(chloromethyl)-1-(2,2-difluoroethyl)imidazole;hydrochloride. InChIKey: GGEKDZFTOSAICP-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2F2N2 |
|---|---|
| Molecular weight | 217.04 g/mol |
| IUPAC name | 2-(chloromethyl)-1-(2,2-difluoroethyl)imidazole;hydrochloride |
| InChIKey | GGEKDZFTOSAICP-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)CCl)CC(F)F.Cl |
Computed by PubChem (NCBI)