CAS 4140-67-4 is the registry number for 2,5-Difluorobenzene-1,4-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2,5-difluorobenzene-1,4-diamine;dihydrochloride (CAS 4140-67-4) is a chemical compound with the molecular formula C6H8Cl2F2N2 and a molecular weight of 217.04 g/mol. IUPAC name: 2,5-difluorobenzene-1,4-diamine;dihydrochloride. InChIKey: YLWMAPWKZWCHKU-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2F2N2 |
|---|---|
| Molecular weight | 217.04 g/mol |
| IUPAC name | 2,5-difluorobenzene-1,4-diamine;dihydrochloride |
| InChIKey | YLWMAPWKZWCHKU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)N)F)N.Cl.Cl |
Computed by PubChem (NCBI)