CAS 2173999-69-2 is the registry number for 6-(Difluoromethyl)pyridin-3-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
6-(difluoromethyl)pyridin-3-amine;dihydrochloride (CAS 2173999-69-2) is a chemical compound with the molecular formula C6H8Cl2F2N2 and a molecular weight of 217.04 g/mol. IUPAC name: 6-(difluoromethyl)pyridin-3-amine;dihydrochloride. InChIKey: JVODKKUKSYLZDX-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2F2N2 |
|---|---|
| Molecular weight | 217.04 g/mol |
| IUPAC name | 6-(difluoromethyl)pyridin-3-amine;dihydrochloride |
| InChIKey | JVODKKUKSYLZDX-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1N)C(F)F.Cl.Cl |
Computed by PubChem (NCBI)