Products 1352085-46-1
CAS 1352085-46-1 appears in our catalog under these names: Naloxone EP Impurity B, Naloxone Impurity 2（Naloxone EP Impurity B）, 3-Allyl Naloxone (1mg/ml in Acetonitrile), 3-Allyl Naloxone, >95% (HPLC), 4,5alpha-Epoxy-14-hydroxy-17-(prop-2-enyl)-3-(prop-2-enyloxy)morphinan-6-one (3-O-Allylnaloxone). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 10x1ml, 250mg.
(4R,4aS,7aR,12bS)-4a-hydroxy-9-prop-2-enoxy-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (CAS 1352085-46-1) is a chemical compound with the molecular formula C22H25NO4 and a molecular weight of 367.4 g/mol. IUPAC name: (4R,4aS,7aR,12bS)-4a-hydroxy-9-prop-2-enoxy-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one. InChIKey: IDDUCSVQXOGMNE-KDXIVRHGSA-N.
| Molecular formula | C22H25NO4 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | (4R,4aS,7aR,12bS)-4a-hydroxy-9-prop-2-enoxy-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| InChIKey | IDDUCSVQXOGMNE-KDXIVRHGSA-N |
| SMILES | C=CCN1CC[C@]23[C@@H]4C(=O)CC[C@]2([C@H]1CC5=C3C(=C(C=C5)OCC=C)O4)O |
Computed by PubChem (NCBI)
Synonyms:
3-O-Allylnaloxone, Naloxone EP Impurity B, 3-Allyl Naloxone, Naloxone hydrochloride dihydrate impurity B [EP], 3-Allyl Naloxone (1mg/ml in Acetonitrile), Naloxone Hydrochloride EP Impurity B, 3-Allyl Naloxone (1 mg/ml in Acetonitrile), NALOXONE HYDROCHLORIDE DIHYDRATE IMPURITY B [EP IMPURITY]