CAS 1352393-65-7 is the registry number for 4-Bromo-5-methoxy-7-methyl-1H-indole 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-bromo-5-methoxy-7-methyl-1H-indole (CAS 1352393-65-7) is a chemical compound with the molecular formula C10H10BrNO and a molecular weight of 240.10 g/mol. IUPAC name: 4-bromo-5-methoxy-7-methyl-1H-indole. InChIKey: NZBDVOBNQVAKPI-UHFFFAOYSA-N.
| Molecular formula | C10H10BrNO |
|---|---|
| Molecular weight | 240.10 g/mol |
| IUPAC name | 4-bromo-5-methoxy-7-methyl-1H-indole |
| InChIKey | NZBDVOBNQVAKPI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1NC=C2)Br)OC |
Computed by PubChem (NCBI)