CAS 135249-30-8 is the registry number for N–(1,3–benzothiazol–6–yl)benzamide. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
N-(1,3-benzothiazol-6-yl)benzamide (CAS 135249-30-8) is a chemical compound with the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. IUPAC name: N-(1,3-benzothiazol-6-yl)benzamide. InChIKey: GYCSEOAIFGSAHQ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2OS |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | N-(1,3-benzothiazol-6-yl)benzamide |
| InChIKey | GYCSEOAIFGSAHQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC3=C(C=C2)N=CS3 |
Computed by PubChem (NCBI)