CAS 321674-89-9 is the registry number for 5-([1,1'-Biphenyl]-4-yl)-1,3,4-oxadiazole-2(3H)-thione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-phenylphenyl)-3H-1,3,4-oxadiazole-2-thione (CAS 321674-89-9) is a chemical compound with the molecular formula C14H10N2OS and a molecular weight of 254.31 g/mol. IUPAC name: 5-(4-phenylphenyl)-3H-1,3,4-oxadiazole-2-thione. InChIKey: HVIFJLXNWHUCBV-UHFFFAOYSA-N.
| Molecular formula | C14H10N2OS |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 5-(4-phenylphenyl)-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | HVIFJLXNWHUCBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NNC(=S)O3 |
Computed by PubChem (NCBI)