CAS 1352638-29-9 is the registry number for 5-(3-Methyl-5-(pyridin-4-yl)-4H-1,2,4-triazol-4-yl)isophthalic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-(3-methyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid (CAS 1352638-29-9) is a chemical compound with the molecular formula C16H12N4O4 and a molecular weight of 324.29 g/mol. IUPAC name: 5-(3-methyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid. InChIKey: DMUBKAYOHBMDJW-UHFFFAOYSA-N.
| Molecular formula | C16H12N4O4 |
|---|---|
| Molecular weight | 324.29 g/mol |
| IUPAC name | 5-(3-methyl-5-pyridin-4-yl-1,2,4-triazol-4-yl)benzene-1,3-dicarboxylic acid |
| InChIKey | DMUBKAYOHBMDJW-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=CC=NC=C3 |
Computed by PubChem (NCBI)