CAS 2244394-30-5 is the registry number for 4,4'-((4H-1,2,4-Triazol-4-yl)azanediyl)dibenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-carboxy-N-(1,2,4-triazol-4-yl)anilino]benzoic acid (CAS 2244394-30-5) is a chemical compound with the molecular formula C16H12N4O4 and a molecular weight of 324.29 g/mol. IUPAC name: 4-[4-carboxy-N-(1,2,4-triazol-4-yl)anilino]benzoic acid. InChIKey: IEDFYRYFVSUMJR-UHFFFAOYSA-N.
| Molecular formula | C16H12N4O4 |
|---|---|
| Molecular weight | 324.29 g/mol |
| IUPAC name | 4-[4-carboxy-N-(1,2,4-triazol-4-yl)anilino]benzoic acid |
| InChIKey | IEDFYRYFVSUMJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N(C2=CC=C(C=C2)C(=O)O)N3C=NN=C3 |
Computed by PubChem (NCBI)