CAS 1815596-32-7 appears in our catalog under these names: 4,4'–(4–Amino–4H–1,2,4–triazole–3,5–diyl)dibenzoic acid, 4,4'-(4-amino-4H-1,2,4-triazole-3,5-diyl)dibenzoic acid, 97%, 97%, 4,4'-(4-Amino-4H-1,2,4-triazole-3,5-diyl)dibenzoic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
4-[4-amino-5-(4-carboxyphenyl)-1,2,4-triazol-3-yl]benzoic acid (CAS 1815596-32-7) is a chemical compound with the molecular formula C16H12N4O4 and a molecular weight of 324.29 g/mol. IUPAC name: 4-[4-amino-5-(4-carboxyphenyl)-1,2,4-triazol-3-yl]benzoic acid. InChIKey: YEGGBYRIRLOQOP-UHFFFAOYSA-N.
| Molecular formula | C16H12N4O4 |
|---|---|
| Molecular weight | 324.29 g/mol |
| IUPAC name | 4-[4-amino-5-(4-carboxyphenyl)-1,2,4-triazol-3-yl]benzoic acid |
| InChIKey | YEGGBYRIRLOQOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(N2N)C3=CC=C(C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)