Products 1352649-44-5
CAS 1352649-44-5 appears in our catalog under these names: TAMRA alkyne, 6–isomer, TAMRA alkyne, 6-isomer, 95.25%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 10 mg, 100 mg, 50 mg.
2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-(prop-2-ynylcarbamoyl)benzoate (CAS 1352649-44-5) is a chemical compound with the molecular formula C28H25N3O4 and a molecular weight of 467.5 g/mol. IUPAC name: 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-(prop-2-ynylcarbamoyl)benzoate. InChIKey: ZKVFIMYNEWHSCO-UHFFFAOYSA-N.
| Molecular formula | C28H25N3O4 |
|---|---|
| Molecular weight | 467.5 g/mol |
| IUPAC name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-(prop-2-ynylcarbamoyl)benzoate |
| InChIKey | ZKVFIMYNEWHSCO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=CC(=C4)C(=O)NCC#C)C(=O)[O-] |
Computed by PubChem (NCBI)