CAS 1417638-37-9 is the registry number for Fmoc-D-His(Bzl)-OH, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(2R)-3-(1-benzylimidazol-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1417638-37-9) is a chemical compound with the molecular formula C28H25N3O4 and a molecular weight of 467.5 g/mol. IUPAC name: (2R)-3-(1-benzylimidazol-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: AZBCBZPTQNYCPF-AREMUKBSSA-N.
| Molecular formula | C28H25N3O4 |
|---|---|
| Molecular weight | 467.5 g/mol |
| IUPAC name | (2R)-3-(1-benzylimidazol-4-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | AZBCBZPTQNYCPF-AREMUKBSSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(N=C2)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)