CAS 945928-17-6 appears in our catalog under these names: TAMRA alkyne, 5-isomer, 95%, TAMRA alkyne, 5–isomer, 5-TAMRA-alkyne, TAMRA alkyne,5-isomer 95%, 2-(3,6-Bis(dimethylamino)xanthylium-9-yl)-5-(prop-2-yn-1-ylcarbamoyl)benzoate, 95%, 95%. Offered by: Lumiprobe, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 50 mg.
2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-(prop-2-ynylcarbamoyl)benzoate (CAS 945928-17-6) is a chemical compound with the molecular formula C28H25N3O4 and a molecular weight of 467.5 g/mol. IUPAC name: 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-(prop-2-ynylcarbamoyl)benzoate. InChIKey: DYDBZMFMNBGTIP-UHFFFAOYSA-N.
| Molecular formula | C28H25N3O4 |
|---|---|
| Molecular weight | 467.5 g/mol |
| IUPAC name | 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-5-(prop-2-ynylcarbamoyl)benzoate |
| InChIKey | DYDBZMFMNBGTIP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=C(C=C4)C(=O)NCC#C)C(=O)[O-] |
Computed by PubChem (NCBI)