CAS 135270-11-0 appears in our catalog under these names: Efinaconazole Impurity 11, Efinaconazole Impurity 19, Efinaconazole Impurity 9, (2R,3S)-2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-2,3-butanediol. Offered by: Hubei YoungXin, Chemat Brand, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request, 500mg.
(2R,3S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol (CAS 135270-11-0) is a chemical compound with the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. IUPAC name: (2R,3S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol. InChIKey: LSCNANBNVFQJDJ-QPUJVOFHSA-N.
| Molecular formula | C12H13F2N3O2 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | (2R,3S)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol |
| InChIKey | LSCNANBNVFQJDJ-QPUJVOFHSA-N |
| SMILES | C[C@@H]([C@](CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)O)O |
Computed by PubChem (NCBI)