CAS 135272-36-5 appears in our catalog under these names: Efinaconazole Impurity 23, (2S,3R)-2-(2,4-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)-2,3-butanediol, Efinaconazole Impurity 13. Offered by: Chemat Brand, TRC, Biosynth, Hubei YoungXin. Available pack sizes: on request, 50mg, 10mg, 5mg, 25mg, 100mg, 200mg.
(2S,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol (CAS 135272-36-5) is a chemical compound with the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. IUPAC name: (2S,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol. InChIKey: LSCNANBNVFQJDJ-PELKAZGASA-N.
| Molecular formula | C12H13F2N3O2 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | (2S,3R)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol |
| InChIKey | LSCNANBNVFQJDJ-PELKAZGASA-N |
| SMILES | C[C@H]([C@@](CN1C=NC=N1)(C2=C(C=C(C=C2)F)F)O)O |
Computed by PubChem (NCBI)