CAS 241479-72-1 appears in our catalog under these names: (2R,3R)-2-(2,5-Difluorophenyl)-1-(1H-1,2,4-triazol-1-yl)butane-2,3-diol, 95%, 95%, Des-4-methylenepiperidine Efinaconazole. Offered by: Chemat, TRC. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
(2R,3R)-2-(2,5-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol (CAS 241479-72-1) is a chemical compound with the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. IUPAC name: (2R,3R)-2-(2,5-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol. InChIKey: WYBYSZZTJKCLBE-PRHODGIISA-N.
| Molecular formula | C12H13F2N3O2 |
|---|---|
| Molecular weight | 269.25 g/mol |
| IUPAC name | (2R,3R)-2-(2,5-difluorophenyl)-1-(1,2,4-triazol-1-yl)butane-2,3-diol |
| InChIKey | WYBYSZZTJKCLBE-PRHODGIISA-N |
| SMILES | C[C@H]([C@](CN1C=NC=N1)(C2=C(C=CC(=C2)F)F)O)O |
Computed by PubChem (NCBI)