Products 1352748-38-9

CAS 1352748-38-9 is the registry number for 2-Amino-3-(tert-butoxy)butanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 1352748-38-9) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: 2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: NMJINEMBBQVPGY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H17NO3
Molecular weight175.23 g/mol
IUPAC name2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid
InChIKeyNMJINEMBBQVPGY-UHFFFAOYSA-N
SMILESCC(C(C(=O)O)N)OC(C)(C)C

Computed by PubChem (NCBI)