CAS 197632-83-0 appears in our catalog under these names: N-Me-ser(tbu)-oh, 95%, N–Me–Ser(Tbu)–OH, H-N-Me-Ser(Tbu)-OH 97%, N-Me-Ser(Tbu)-OH, 97%, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 5g, 250mg.
(2S)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid (CAS 197632-83-0) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (2S)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid. InChIKey: DLTSMSCPUUWYDX-LURJTMIESA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (2S)-2-(methylamino)-3-[(2-methylpropan-2-yl)oxy]propanoic acid |
| InChIKey | DLTSMSCPUUWYDX-LURJTMIESA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)O)NC |
Computed by PubChem (NCBI)