Products 49642-07-1
CAS 49642-07-1 appears in our catalog under these names: (3S,4S)-4-Amino-3-hydroxy-6-methylheptanoic acid hydrochloride, 95%, Statine ((3S,4S)–Statine), Statine (Standard), Statine, 99.83%. Offered by: Combi-blocks, GLPBio, MedChemExpress. Available pack sizes: 250mg, 100mg, 10mg, 5mg, Get quote, 5 mg, 10 mg.
(3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid (CAS 49642-07-1) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid. InChIKey: DFVFTMTWCUHJBL-BQBZGAKWSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (3S,4S)-4-amino-3-hydroxy-6-methylheptanoic acid |
| InChIKey | DFVFTMTWCUHJBL-BQBZGAKWSA-N |
| SMILES | CC(C)C[C@@H]([C@H](CC(=O)O)O)N |
Computed by PubChem (NCBI)