CAS 1352887-12-7 is the registry number for 3,5,6-Trichloro-1,2-benzoxazole, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3,5,6-trichloro-1,2-benzoxazole (CAS 1352887-12-7) is a chemical compound with the molecular formula C7H2Cl3NO and a molecular weight of 222.5 g/mol. IUPAC name: 3,5,6-trichloro-1,2-benzoxazole. InChIKey: ZAQIYHJMWDVLNY-UHFFFAOYSA-N.
| Molecular formula | C7H2Cl3NO |
|---|---|
| Molecular weight | 222.5 g/mol |
| IUPAC name | 3,5,6-trichloro-1,2-benzoxazole |
| InChIKey | ZAQIYHJMWDVLNY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)ON=C2Cl |
Computed by PubChem (NCBI)