CAS 1352887-90-1 appears in our catalog under these names: 2-(5-Bromo-1h-indazol-3-yl)acetonitrile, 95%, 2–(5–Bromo–1H–indazol–3–yl)acetonitrile. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg, 20mg.
2-(5-bromo-2H-indazol-3-yl)acetonitrile (CAS 1352887-90-1) is a chemical compound with the molecular formula C9H6BrN3 and a molecular weight of 236.07 g/mol. IUPAC name: 2-(5-bromo-2H-indazol-3-yl)acetonitrile. InChIKey: RPIYPKMKTJJQST-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 2-(5-bromo-2H-indazol-3-yl)acetonitrile |
| InChIKey | RPIYPKMKTJJQST-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNC(=C2C=C1Br)CC#N |
Computed by PubChem (NCBI)