CAS 1951445-04-7 is the registry number for 7-Bromo-2-methyl-1H-1,3-benzodiazole-5-carbonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
7-bromo-2-methyl-3H-benzimidazole-5-carbonitrile (CAS 1951445-04-7) is a chemical compound with the molecular formula C9H6BrN3 and a molecular weight of 236.07 g/mol. IUPAC name: 7-bromo-2-methyl-3H-benzimidazole-5-carbonitrile. InChIKey: RCNCHDDFAYNHMF-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 7-bromo-2-methyl-3H-benzimidazole-5-carbonitrile |
| InChIKey | RCNCHDDFAYNHMF-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2Br)C#N |
Computed by PubChem (NCBI)