CAS 1518113-22-8 is the registry number for 7-Bromo-2-methyl-2H-indazole-3-carbonitrile. Offered by: TRC. Available pack sizes: 100mg.
7-bromo-2-methylindazole-3-carbonitrile (CAS 1518113-22-8) is a chemical compound with the molecular formula C9H6BrN3 and a molecular weight of 236.07 g/mol. IUPAC name: 7-bromo-2-methylindazole-3-carbonitrile. InChIKey: HKUKUTKTSWQBGA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN3 |
|---|---|
| Molecular weight | 236.07 g/mol |
| IUPAC name | 7-bromo-2-methylindazole-3-carbonitrile |
| InChIKey | HKUKUTKTSWQBGA-UHFFFAOYSA-N |
| SMILES | CN1C(=C2C=CC=C(C2=N1)Br)C#N |
Computed by PubChem (NCBI)