CAS 1352893-80-1 is the registry number for 3,6-Dichloro-1H-pyrazolo(3,4-b)pyridine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3,6-dichloro-2H-pyrazolo[3,4-b]pyridine (CAS 1352893-80-1) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 3,6-dichloro-2H-pyrazolo[3,4-b]pyridine. InChIKey: NCDZEFDEWHLHQC-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 3,6-dichloro-2H-pyrazolo[3,4-b]pyridine |
| InChIKey | NCDZEFDEWHLHQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NNC(=C21)Cl)Cl |
Computed by PubChem (NCBI)