CAS 1353006-45-7 is the registry number for Benzyl (3S)-morpholine-3-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Benzyl (3S)-morpholine-3-carboxylate;hydrochloride (CAS 1353006-45-7) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: benzyl (3S)-morpholine-3-carboxylate;hydrochloride. InChIKey: CVKABBHCEVSVII-MERQFXBCSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | benzyl (3S)-morpholine-3-carboxylate;hydrochloride |
| InChIKey | CVKABBHCEVSVII-MERQFXBCSA-N |
| SMILES | C1COC[C@H](N1)C(=O)OCC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)