CAS 135307-33-4 is the registry number for GW549390X. Offered by: MedChemExpress. Available pack sizes: Get quote.
N,5-diphenyl-1,3-oxazol-2-amine (CAS 135307-33-4) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. IUPAC name: N,5-diphenyl-1,3-oxazol-2-amine. InChIKey: HFICAVMUTYFODG-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | N,5-diphenyl-1,3-oxazol-2-amine |
| InChIKey | HFICAVMUTYFODG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)