Products 1353100-79-4

CAS 1353100-79-4 is the registry number for Methyl 5-bromo-4-methoxythiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 5-bromo-4-methoxythiophene-3-carboxylate (CAS 1353100-79-4) is a chemical compound with the molecular formula C7H7BrO3S and a molecular weight of 251.10 g/mol. IUPAC name: methyl 5-bromo-4-methoxythiophene-3-carboxylate. InChIKey: OCCQKIJKMWFSDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BrO3S
Molecular weight251.10 g/mol
IUPAC namemethyl 5-bromo-4-methoxythiophene-3-carboxylate
InChIKeyOCCQKIJKMWFSDJ-UHFFFAOYSA-N
SMILESCOC1=C(SC=C1C(=O)OC)Br

Computed by PubChem (NCBI)