Products 1353500-82-9
CAS 1353500-82-9 is the registry number for Ethyl 3-oxo-1,2,3,4-tetrahydroquinoxaline-6-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylate (CAS 1353500-82-9) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: ethyl 3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylate. InChIKey: ZWJQQFCMPAONCU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | ethyl 3-oxo-2,4-dihydro-1H-quinoxaline-6-carboxylate |
| InChIKey | ZWJQQFCMPAONCU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NCC(=O)N2 |
Computed by PubChem (NCBI)