Products 1353502-91-6
CAS 1353502-91-6 is the registry number for tert-Butyl 3,3-dimethyl-5-oxopiperazine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3,3-dimethyl-5-oxopiperazine-1-carboxylate (CAS 1353502-91-6) is a chemical compound with the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. IUPAC name: tert-butyl 3,3-dimethyl-5-oxopiperazine-1-carboxylate. InChIKey: QXGRPROTYZUJIO-UHFFFAOYSA-N.
| Molecular formula | C11H20N2O3 |
|---|---|
| Molecular weight | 228.29 g/mol |
| IUPAC name | tert-butyl 3,3-dimethyl-5-oxopiperazine-1-carboxylate |
| InChIKey | QXGRPROTYZUJIO-UHFFFAOYSA-N |
| SMILES | CC1(CN(CC(=O)N1)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)