CAS 1353636-82-4 appears in our catalog under these names: 3–Amino–3–(4–methoxyphenyl)cyclobutan–1–ol, 3-Amino-3-(4-methoxyphenyl)cyclobutan-1-ol, 95%, 95%, 3-Amino-3-(4-methoxyphenyl)cyclobutan-1-ol, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 1g, 250mg.
3-amino-3-(4-methoxyphenyl)cyclobutan-1-ol (CAS 1353636-82-4) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: 3-amino-3-(4-methoxyphenyl)cyclobutan-1-ol. InChIKey: TYBCCVMYRJUCOA-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 3-amino-3-(4-methoxyphenyl)cyclobutan-1-ol |
| InChIKey | TYBCCVMYRJUCOA-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(CC(C2)O)N |
Computed by PubChem (NCBI)