CAS 1353742-19-4 is the registry number for (1S,2S,3R,5R)-2-((Benzyloxy)methyl)-6-oxabicyclo[3.1.0]hexan-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2S,3R,5R)-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-3-ol (CAS 1353742-19-4) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: (1S,2S,3R,5R)-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-3-ol. InChIKey: LPHHAQDOQOLDFK-LOWDOPEQSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | (1S,2S,3R,5R)-2-(phenylmethoxymethyl)-6-oxabicyclo[3.1.0]hexan-3-ol |
| InChIKey | LPHHAQDOQOLDFK-LOWDOPEQSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]2[C@@H]1O2)COCC3=CC=CC=C3)O |
Computed by PubChem (NCBI)