CAS 1353978-24-1 is the registry number for 2-Chloro-N-isoquinolin-1-ylmethyl-acetamide. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 2g.
2-chloro-N-(isoquinolin-1-ylmethyl)acetamide (CAS 1353978-24-1) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 2-chloro-N-(isoquinolin-1-ylmethyl)acetamide. InChIKey: ZXVGQWFUMQZPIS-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-chloro-N-(isoquinolin-1-ylmethyl)acetamide |
| InChIKey | ZXVGQWFUMQZPIS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CN=C2CNC(=O)CCl |
Computed by PubChem (NCBI)